Drugs present in MMsINC which are similar to the molecule MMscode: MMs02536418
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724833 | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.83 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.77 |
MMs01725217 | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.76 |
MMs01726898 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.76 |
MMs01725453 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.76 |
MMs01725702 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.76 |
MMs01725765 | O=C1N2N(c3cc(ccc3N=C2N(C)C)C)C(=O)C1CCC | 0.74 |
MMs01724986 | O=C1N2N(c3cc(ccc3N=C2N(C)C)C)C(=O)C1CCC | 0.74 |
MMs01726915 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.73 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.72 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |