Drugs present in MMsINC which are similar to the molecule MMscode: MMs02463347
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726243 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726245 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726247 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726249 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01725485 | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.72 |