Drugs present in MMsINC which are similar to the molecule MMscode: MMs02460674
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726862 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.71 |
MMs01726859 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.71 |
MMs01726860 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.71 |
MMs01726861 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.71 |
MMs01725455 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725771 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725866 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.70 |