Drugs present in MMsINC which are similar to the molecule MMscode: MMs02440248
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725833![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725954![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725956![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725809![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725958![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01725834![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01725836![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |
MMs01725636![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.71 |