Drugs present in MMsINC which are similar to the molecule MMscode: MMs02387801
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.80 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.80 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.77 |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.77 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.73 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.71 |