Drugs present in MMsINC which are similar to the molecule MMscode: MMs02349522
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.78 |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.72 |
MMs01725172 | Fc1c(N2CC(NC(C2)C)C)c(F)c2N(C=C(C(O)=O)C(=O)c2c1N)C1CC1 | 0.70 |
MMs01725420 | Fc1c(N2CC(NC(C2)C)C)c(F)c2N(C=C(C(O)=O)C(=O)c2c1N)C1CC1 | 0.70 |
MMs01725421 | Fc1c(N2CC(NC(C2)C)C)c(F)c2N(C=C(C(O)=O)C(=O)c2c1N)C1CC1 | 0.70 |