Drugs present in MMsINC which are similar to the molecule MMscode: MMs02272890
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724833 | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.73 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.71 |
MMs01725765 | O=C1N2N(c3cc(ccc3N=C2N(C)C)C)C(=O)C1CCC | 0.70 |