Drugs present in MMsINC which are similar to the molecule MMscode: MMs02227992
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.73 |
MMs01725206 | O(C)c1c(OC)cc(NCc2ccc3nc(nc(N)c3c2C)N)cc1OC | 0.73 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.72 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.72 |
MMs01725053 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.72 |
MMs01725051 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.72 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.71 |
MMs01725466 | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01725468 | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01726582 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726584 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726586 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |
MMs01726588 | O(C)C1C(C2C(CC1OC(=O)c1cc(OC)c(OC)c(OC)c1)CN1C(C2)c2[nH]c3c(c2CC1)cccc3)C(OC)=O | 0.71 |