Drugs present in MMsINC which are similar to the molecule MMscode: MMs02129934
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.82 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.78 |
MMs01724959 | Clc1cccc(Cl)c1N(CC=C)C1=[NH+]CCN1 | 0.78 |
MMs01725291 | Clc1cccc(Cl)c1N=C1NCCN1 | 0.72 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.70 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |