Drugs present in MMsINC which are similar to the molecule MMscode: MMs01966289
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725185 | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.75 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.73 |
MMs01725118 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.71 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |