Drugs present in MMsINC which are similar to the molecule MMscode: MMs01893833
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.78 |
MMs01727243 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.78 |
MMs01725615 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.73 |
MMs01725779 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.73 |
MMs01725261 | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.73 |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.72 |
MMs01725701 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.72 |
MMs01727136 | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.71 |
MMs01724835 | O1c2c(cc(cc2)C(C)C)C(=O)c2cc(C(O)=O)c(nc12)N | 0.71 |
MMs01725311 | S(=O)(=O)(NC(=O)c1cc(OC)c(cc1)Cc1c2cc(NC(OC3CCCC3)=O)ccc2n(c1)C)c1ccccc1C | 0.71 |
MMs01725895 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |
MMs01727297 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |