Drugs present in MMsINC which are similar to the molecule MMscode: MMs01782216
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725779 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.75 |
MMs01727755 | O(C)c1cc2N(C3C4(C5N(CC4)CC=CC5(CC)C(O)C3(O)C(=O)N)c2cc1C1(CC2CC(O)(CN(C2)CCc2c1[nH]c1c2cccc1)CC)C(OC)=O)C | 0.71 |
MMs01727759 | O(C)c1cc2N(C3C4(C5N(CC4)CC=CC5(CC)C(O)C3(O)C(=O)N)c2cc1C1(CC2CC(O)(CN(C2)CCc2c1[nH]c1c2cccc1)CC)C(OC)=O)C | 0.71 |
MMs01727761 | O(C)c1cc2N(C3C4(C5N(CC4)CC=CC5(CC)C(O)C3(O)C(=O)N)c2cc1C1(CC2CC(O)(CN(C2)CCc2c1[nH]c1c2cccc1)CC)C(OC)=O)C | 0.71 |
MMs01727757 | O(C)c1cc2N(C3C4(C5N(CC4)CC=CC5(CC)C(O)C3(O)C(=O)N)c2cc1C1(CC2CC(O)(CN(C2)CCc2c1[nH]c1c2cccc1)CC)C(OC)=O)C | 0.71 |
MMs01725053 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.71 |
MMs01725051 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.71 |