Drugs present in MMsINC which are similar to the molecule MMscode: MMs01729712
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.75 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.74 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.73 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.72 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |
MMs01726626 | [NH2+]=C(N)c1ccc(NN=Nc2ccc(cc2)C(=[NH2+])N)cc1 | 0.70 |