Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726917
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725141 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 1.00 |
MMs01725416 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.94 |
MMs01725098 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.94 |
MMs01726143 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.87 |
MMs01726141 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.87 |
MMs01726139 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.87 |
MMs01725429 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.76 |
MMs01725443 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.76 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.75 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.75 |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.73 |
MMs01726114 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726116 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726118 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726112 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.70 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.70 |