Drugs present in MMsINC which are similar to the molecule MMscode: MMs01720120
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.76 |
MMs01725190 | Clc1cc(O)c(cc1S(=O)(=O)N)C(=O)Nc1c(cccc1C)C | 0.75 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.72 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.70 |
MMs01726749 | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.70 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.70 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.70 |