Drugs present in MMsINC which are similar to the molecule MMscode: MMs01683079
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726941![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.72 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.71 |
MMs01725288![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.71 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.71 |
MMs01727042![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01724995![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01725031![]() | S1Cc2c(cccc2)\C(\c2c1cccc2)=C/CC[NH+](C)C | 0.71 |