Drugs present in MMsINC which are similar to the molecule MMscode: MMs01644967
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727026![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.74 |
MMs01725868![]() | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.74 |
MMs01725207![]() | S(=O)(Cc1nccc(OCC(F)(F)F)c1C)c1[nH]c2c(n1)cccc2 | 0.73 |
MMs01725413![]() | S(=O)(Cc1ncc(C)c(OC)c1C)c1[nH]c2c(n1)cc(OC)cc2 | 0.73 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.73 |
MMs01725466![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01725468![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01725205![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.70 |
MMs01725422![]() | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.70 |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.70 |