Drugs present in MMsINC which are similar to the molecule MMscode: MMs01522879
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725219 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.82 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.82 |
MMs01725623 | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.78 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.75 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.75 |
MMs01725941 | S(=O)(=O)(N)c1cc(cc(NCCCC)c1Oc1ccccc1)C(O)=O | 0.74 |
MMs01725935 | S(=O)(=O)(N)c1cc(cc(N2CCCC2)c1Oc1ccccc1)C(O)=O | 0.72 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.71 |