Drugs present in MMsINC which are similar to the molecule MMscode: MMs01500589
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.76 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.75 |
MMs01726110![]() | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.73 |
MMs01726126![]() | O(CC(O)CNC(C)(C)C)c1c2c(ccc1)C(=O)CCC2 | 0.73 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.72 |
MMs01725170![]() | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.72 |
MMs01725084![]() | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.71 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |