Drugs present in MMsINC which are similar to the molecule MMscode: MMs01395863
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725048![]() | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.78 |
MMs01727224![]() | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.78 |
MMs01725364![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.74 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.74 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.74 |
MMs01725362![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.74 |
MMs01726677![]() | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01726675![]() | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |










