Drugs present in MMsINC which are similar to the molecule MMscode: MMs01365693
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.77 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.74 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01727141 | O=C1N(c2c(cc([N+](=O)[O-])cc2)C(=NC1)c1ccccc1)C | 0.71 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |