Drugs present in MMsINC which are similar to the molecule MMscode: MMs01232468
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725677 | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.75 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.72 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.70 |
MMs01727243 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.70 |
MMs01724962 | Oc1nc(C)c(cc1C#N)-c1ccncc1 | 0.70 |