Drugs present in MMsINC which are similar to the molecule MMscode: MMs01147509
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.86 |
MMs01724928![]() | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.76 |
MMs01724998![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.75 |
MMs01725025![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.75 |
MMs01725677![]() | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.70 |