Drugs present in MMsINC which are similar to the molecule MMscode: MMs01042789
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.78 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.78 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.77 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.77 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.75 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.74 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.74 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.72 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.72 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.71 |
MMs01724926 | O=C1N=C(c2c(N1C(C)C)cc(cc2)C)c1ccccc1 | 0.71 |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.70 |