Drugs present in MMsINC which are similar to the molecule MMscode: MMs00964442
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724724![]() | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.75 |
MMs01725708![]() | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.75 |
MMs01724786![]() | O1CCN(CC1)CC1CCc2[nH]c(C)c(c2C1=O)CC | 0.73 |
MMs01725096![]() | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.72 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.70 |