Drugs present in MMsINC which are similar to the molecule MMscode: MMs00896558
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725765 | O=C1N2N(c3cc(ccc3N=C2N(C)C)C)C(=O)C1CCC | 0.75 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.72 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.72 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |