Drugs present in MMsINC which are similar to the molecule MMscode: MMs00837068
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.78 |
MMs01724957 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.78 |
MMs01724939 | Clc1c(Cl)c(OCC(O)=O)ccc1C(=O)c1sccc1 | 0.76 |
MMs01725170 | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.71 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 |
MMs01724997 | S(=O)(=O)(C)c1ccc(cc1)C=1COC(=O)C=1c1ccccc1 | 0.71 |
MMs01725897 | O(C)c1cc(C)c(\C=C\C(=C/C=C/C(=C\C(O)=O)/C)\C)c(C)c1C | 0.70 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.70 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.70 |