Drugs present in MMsINC which are similar to the molecule MMscode: MMs00821884
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.80 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.71 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.71 |