Drugs present in MMsINC which are similar to the molecule MMscode: MMs00711223
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.74 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.73 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.70 |
MMs01724727 | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.70 |