Drugs present in MMsINC which are similar to the molecule MMscode: MMs00701968
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.73 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01724901 | O(C(=O)C1(CCN(CC1)C)c1ccccc1)CC | 0.71 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |