Drugs present in MMsINC which are similar to the molecule MMscode: MMs00552062
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724833![]() | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.71 |
MMs01725672![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.71 |
MMs01725798![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.71 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01724876![]() | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.71 |