Drugs present in MMsINC which are similar to the molecule MMscode: MMs00485218
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727280 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.77 |
MMs01727282 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.77 |
MMs01727284 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.77 |
MMs01725106 | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.75 |
MMs01725107 | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.75 |