Drugs present in MMsINC which are similar to the molecule MMscode: MMs00483428
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726808 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.81 |
MMs01726812 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.81 |
MMs01726810 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.81 |
MMs01727069 | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727063 | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727065 | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727067 | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01726510 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.73 |
MMs01726516 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.73 |
MMs01726514 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.73 |
MMs01726512 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C1(N)CCCCC1 | 0.73 |