Drugs present in MMsINC which are similar to the molecule MMscode: MMs00460542
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.72 |
MMs01727253 | ClCCN(CCCl)c1ccc(cc1)CCCC(OCC(=O)C1(O)CCC2C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)=O | 0.72 |
MMs01727254 | ClCCN(CCCl)c1ccc(cc1)CCCC(OCC(=O)C1(O)CCC2C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)=O | 0.72 |
MMs01727255 | ClCCN(CCCl)c1ccc(cc1)CCCC(OCC(=O)C1(O)CCC2C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)=O | 0.72 |
MMs01727256 | ClCCN(CCCl)c1ccc(cc1)CCCC(OCC(=O)C1(O)CCC2C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)=O | 0.72 |