Drugs present in MMsINC which are similar to the molecule MMscode: MMs00280506
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.77 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.73 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.71 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.71 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |