Drugs present in MMsINC which are similar to the molecule MMscode: MMs00266976
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.78 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.78 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.75 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |