Drugs present in MMsINC which are similar to the molecule MMscode: MMs00137809
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.85 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.85 |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.78 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.73 |
MMs01727136 | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.72 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.72 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.72 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.71 |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.70 |
MMs01726846 | O(C(=O)c1cccnc1)C1C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1OC(=O)c1cccnc1 | 0.70 |