Drugs present in MMsINC which are similar to the molecule MMscode: MMs00127118
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727465 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.72 |
MMs01727466 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.72 |
MMs01727467 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.72 |
MMs01727464 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.72 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.72 |
MMs01724829 | s1c2c(cc1C(N(O)C(=O)N)C)cccc2 | 0.71 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.71 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.71 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.70 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |