Drugs present in MMsINC which are similar to the molecule MMscode: MMs00024799
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.89 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.89 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.89 |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.89 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.72 |