Drugs present in MMsINC which are similar to the molecule MMscode: MMs00015783
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.79 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.79 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.76 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.76 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.71 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.70 |