 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(C(NC(=O)C1[NH2+]CCC1)C(=O)N1CCCC1C(=O)NC(C(=O)N)CO)C |
| InChI: | InChI=1/C17H29N5O6/c1-9(24)13(21-15(26)10-4-2-6-19-10)17(28)22-7-3-5-12(22)16(27)20-11(8-23)14(18)25/h9-13,19,23-24H,2-8H2,1H3,(H2,18,25)(H,20,27)(H,21,26)/p+1/t9-,10+,11+,12-,13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.4934 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 400.456 g/mol | logS: -1.05026 | SlogP: -4.4688 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.134153 | Sterimol/B1: 2.56229 | Sterimol/B2: 4.84244 | Sterimol/B3: 6.22876 | |||
| Sterimol/B4: 6.89589 | Sterimol/L: 16.0552 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 643.959 | Positive charged surface: 489.594 | Negative charged surface: 154.364 | Volume: 372.625 | |||
| Hydrophobic surface: 363.813 | Hydrophilic surface: 280.146 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
