 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCCCCC[NH3+])C1OC(CO)C(O)C(O)C1NC(=O)C |
| InChI: | InChI=1/C14H28N2O5S/c1-9(18)16-11-13(20)12(19)10(8-17)21-14(11)22-7-5-3-2-4-6-15/h10-14,17,19-20H,2-8,15H2,1H3,(H,16,18)/p+1/t10-,11+,12+,13-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=42.8617 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 337.461 g/mol | logS: -0.80099 | SlogP: -1.5344 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0512721 | Sterimol/B1: 2.21597 | Sterimol/B2: 2.50849 | Sterimol/B3: 5.18624 | |||
| Sterimol/B4: 8.55275 | Sterimol/L: 17.9515 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 618.306 | Positive charged surface: 476.993 | Negative charged surface: 141.313 | Volume: 321.375 | |||
| Hydrophobic surface: 383.829 | Hydrophilic surface: 234.477 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
