 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC(CC)C(=O)[O-])(OP(O)(O)=O)(=O)C(N)C |
| InChI: | InChI=1/C6H15NO8P2/c1-3-5(6(8)9)14-16(10,4(2)7)15-17(11,12)13/h4-5H,3,7H2,1-2H3,(H,8,9)(H2,11,12,13)/p-1/t4-,5-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-74.489 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 290.125 g/mol | logS: 0.26165 | SlogP: -3.0018 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.180346 | Sterimol/B1: 2.32949 | Sterimol/B2: 4.48997 | Sterimol/B3: 4.97696 | |||
| Sterimol/B4: 5.53544 | Sterimol/L: 11.5342 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 433.531 | Positive charged surface: 240.772 | Negative charged surface: 192.759 | Volume: 215 | |||
| Hydrophobic surface: 167.328 | Hydrophilic surface: 266.203 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
