 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCCNC(=[NH2+])N)C(=O)[O-])C([NH3+])C(C)C |
| InChI: | InChI=1/C11H23N5O3/c1-6(2)8(12)9(17)16-7(10(18)19)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/p+1/t7-,8-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-68.2577 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 274.345 g/mol | logS: -1.11681 | SlogP: -5.0688 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0394931 | Sterimol/B1: 3.19242 | Sterimol/B2: 3.39071 | Sterimol/B3: 3.62938 | |||
| Sterimol/B4: 4.59409 | Sterimol/L: 16.2955 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 518.219 | Positive charged surface: 399.283 | Negative charged surface: 118.936 | Volume: 269.125 | |||
| Hydrophobic surface: 220.094 | Hydrophilic surface: 298.125 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
