 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCO)C1OC(C(NC(=O)C2[NH+](CCC2)C)C(OC)C)C(O)C(O)C1O |
| InChI: | InChI=1/C17H32N2O7S/c1-9(25-3)11(18-16(24)10-5-4-6-19(10)2)15-13(22)12(21)14(23)17(26-15)27-8-7-20/h9-15,17,20-23H,4-8H2,1-3H3,(H,18,24)/p+1/t9-,10-,11+,12-,13+,14-,15+,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.374 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 409.524 g/mol | logS: -1.01277 | SlogP: -3.2837 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.10154 | Sterimol/B1: 2.09087 | Sterimol/B2: 2.53987 | Sterimol/B3: 5.52702 | |||
| Sterimol/B4: 8.43457 | Sterimol/L: 16.9716 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 642.256 | Positive charged surface: 506.399 | Negative charged surface: 135.857 | Volume: 381.75 | |||
| Hydrophobic surface: 401.177 | Hydrophilic surface: 241.079 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 8 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
