Type: Neutral
Formula: C9H13N3O7
SMILES: |
O1C(C(O)CO)C(O)C(O)C1N1N=CC(=O)NC1=O |
InChI: |
InChI=1/C9H13N3O7/c13-2-3(14)7-5(16)6(17)8(19-7)12-9(18)11-4(15)1-10-12/h1,3,5-8,13-14,16-17H,2H2,(H,11,15,18)/t3-,5+,6-,7+,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 275.217 g/mol | logS: 0.36422 | SlogP: -3.6761 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.197466 | Sterimol/B1: 2.51791 | Sterimol/B2: 3.52044 | Sterimol/B3: 5.53246 |
Sterimol/B4: 5.87261 | Sterimol/L: 12.3919 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 441.3 | Positive charged surface: 316.677 | Negative charged surface: 124.623 | Volume: 217.75 |
Hydrophobic surface: 123.246 | Hydrophilic surface: 318.054 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |