 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCCNC(=[NH2+])N)C(=O)[O-])CNC(=O)C[NH3+] |
| InChI: | InChI=1/C10H20N6O4/c11-4-7(17)15-5-8(18)16-6(9(19)20)2-1-3-14-10(12)13/h6H,1-5,11H2,(H,15,17)(H,16,18)(H,19,20)(H4,12,13,14)/p+1/t6-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-33.7433 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 289.316 g/mol | logS: -0.55863 | SlogP: -6.9772 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0331703 | Sterimol/B1: 2.82827 | Sterimol/B2: 3.23236 | Sterimol/B3: 5.55206 | |||
| Sterimol/B4: 6.15694 | Sterimol/L: 16.3092 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 563.635 | Positive charged surface: 431.112 | Negative charged surface: 132.523 | Volume: 267.125 | |||
| Hydrophobic surface: 164.826 | Hydrophilic surface: 398.809 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
