 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(O)C[NH3+])C1OC(CO)C(O)C(O)C1NC(=O)C |
| InChI: | InChI=1/C11H22N2O6S/c1-5(15)13-8-10(18)9(17)7(3-14)19-11(8)20-4-6(16)2-12/h6-11,14,16-18H,2-4,12H2,1H3,(H,13,15)/p+1/t6-,7+,8-,9-,10+,11-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.533 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 311.379 g/mol | logS: 0.20863 | SlogP: -3.7339 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.109524 | Sterimol/B1: 2.11981 | Sterimol/B2: 2.5274 | Sterimol/B3: 5.27769 | |||
| Sterimol/B4: 8.62626 | Sterimol/L: 14.0752 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 527.107 | Positive charged surface: 389.44 | Negative charged surface: 137.667 | Volume: 279.125 | |||
| Hydrophobic surface: 271.79 | Hydrophilic surface: 255.317 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
