 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC(O)C(O)C(O)C(NC(=O)C)C=O)(=O)([O-])[O-] |
| InChI: | InChI=1/C8H16NO9P/c1-4(11)9-5(2-10)7(13)8(14)6(12)3-18-19(15,16)17/h2,5-8,12-14H,3H2,1H3,(H,9,11)(H2,15,16,17)/p-2/t5-,6+,7+,8+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=25.9995 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 299.172 g/mol | logS: 1.07652 | SlogP: -5.4522 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0793895 | Sterimol/B1: 2.34033 | Sterimol/B2: 3.41233 | Sterimol/B3: 3.696 | |||
| Sterimol/B4: 6.73016 | Sterimol/L: 14.8857 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 479.562 | Positive charged surface: 228.689 | Negative charged surface: 250.873 | Volume: 229.875 | |||
| Hydrophobic surface: 166.772 | Hydrophilic surface: 312.79 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
