Type: Ionized
Formula: C8H14NO8-
SMILES: |
OC(C(O)C(O)CO)C(O)C(=O)NCC(=O)[O-] |
InChI: |
InChI=1/C8H15NO8/c10-2-3(11)5(14)6(15)7(16)8(17)9-1-4(12)13/h3,5-7,10-11,14-16H,1-2H2,(H,9,17)(H,12,13)/p-1/t3-,5-,6-,7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 252.199 g/mol | logS: 0.9933 | SlogP: -5.7116 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0484591 | Sterimol/B1: 2.82599 | Sterimol/B2: 3.11094 | Sterimol/B3: 4.17152 |
Sterimol/B4: 4.89315 | Sterimol/L: 13.8988 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 432.328 | Positive charged surface: 276.504 | Negative charged surface: 155.824 | Volume: 203.25 |
Hydrophobic surface: 147.791 | Hydrophilic surface: 284.537 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|